cas: 955-98-6 — see every product listed under this CAS number, including other names
4,4'-Dimethylazoxybenzene, 97%, 97% (CAS 955-98-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117CCU-250mg |
| cas | 955-98-6 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 750.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium (CAS 955-98-6) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: (4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium. InChIKey: SDCOJRCIBWCATN-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (4-methylphenyl)-(4-methylphenyl)imino-oxidoazanium |
| InChIKey | SDCOJRCIBWCATN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=[N+](C2=CC=C(C=C2)C)[O-] |
Computed by PubChem (NCBI)