CAS 20246-81-5 appears in our catalog under these names: 4,4'–Dinitro–(1,1'–biphenyl)–2,2'–dicarboxylic acid, 4,4'-Dinitro-[1,1'-biphenyl]-2,2'-dicarboxylic acid, 97%, 97%, 4,4'-Dinitro-[1,1'-biphenyl]-2,2'-dicarboxylic acid, 98%, 4,4'-Dinitro-[1,1'-biphenyl]-2,2'-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g.
2-(2-carboxy-4-nitrophenyl)-5-nitrobenzoic acid (CAS 20246-81-5) is a chemical compound with the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. IUPAC name: 2-(2-carboxy-4-nitrophenyl)-5-nitrobenzoic acid. InChIKey: CDYUHLLQUAYYHD-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O8 |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 2-(2-carboxy-4-nitrophenyl)-5-nitrobenzoic acid |
| InChIKey | CDYUHLLQUAYYHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)C2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)