Products 144949-59-7

CAS 144949-59-7 is the registry number for 5,5'-Dinitro-[1,1'-biphenyl]-3,3'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid (CAS 144949-59-7) is a chemical compound with the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. IUPAC name: 3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid. InChIKey: XVJSFQJMJQNVGO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2O8
Molecular weight332.22 g/mol
IUPAC name3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid
InChIKeyXVJSFQJMJQNVGO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)[N+](=O)[O-])C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)