CAS 144949-59-7 is the registry number for 5,5'-Dinitro-[1,1'-biphenyl]-3,3'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid (CAS 144949-59-7) is a chemical compound with the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. IUPAC name: 3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid. InChIKey: XVJSFQJMJQNVGO-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O8 |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 3-(3-carboxy-5-nitrophenyl)-5-nitrobenzoic acid |
| InChIKey | XVJSFQJMJQNVGO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)[N+](=O)[O-])C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)