Products 41725-30-8

CAS 41725-30-8 is the registry number for 2,2'-Dinitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid (CAS 41725-30-8) is a chemical compound with the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. IUPAC name: 4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid. InChIKey: HRGSKQRXBGCEAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2O8
Molecular weight332.22 g/mol
IUPAC name4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid
InChIKeyHRGSKQRXBGCEAZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)