CAS 41725-30-8 is the registry number for 2,2'-Dinitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid (CAS 41725-30-8) is a chemical compound with the molecular formula C14H8N2O8 and a molecular weight of 332.22 g/mol. IUPAC name: 4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid. InChIKey: HRGSKQRXBGCEAZ-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O8 |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid |
| InChIKey | HRGSKQRXBGCEAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)