cas: 1106871-37-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3,2-dioxaborolane 95% (CAS 1106871-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A718116-100mg |
| cas | 1106871-37-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 25g | 6984.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A718116 |
2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1106871-37-7) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JAEUAPKITKWJML-UHFFFAOYSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JAEUAPKITKWJML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC3(CC2)OCCO3 |
Computed by PubChem (NCBI)