cas: 1106871-37-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3,2-dioxaborolane, 95%, 95% (CAS 1106871-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119S22-100mg |
| cas | 1106871-37-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 25g | 4624.40 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 10g | 2195.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1106871-37-7) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JAEUAPKITKWJML-UHFFFAOYSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JAEUAPKITKWJML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC3(CC2)OCCO3 |
Computed by PubChem (NCBI)