cas: 1106871-37-7 — see every product listed under this CAS number, including other names
8-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4-dioxaspiro[4.5]decane, 98% (CAS 1106871-37-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223242-1G |
| cas | 1106871-37-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 250mg | 200.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1106871-37-7) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JAEUAPKITKWJML-UHFFFAOYSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JAEUAPKITKWJML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC3(CC2)OCCO3 |
Computed by PubChem (NCBI)