cas: 1073339-11-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane 97% (CAS 1073339-11-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1004736-100mg |
| cas | 1073339-11-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 720.81 Pln | |
| Ambeed | 5g | 2356.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1004736 |
4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane (CAS 1073339-11-3) is a chemical compound with the molecular formula C12H13BF4O2 and a molecular weight of 276.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane. InChIKey: MSEFKALUUBYZOK-UHFFFAOYSA-N.
| Molecular formula | C12H13BF4O2 |
|---|---|
| Molecular weight | 276.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrafluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | MSEFKALUUBYZOK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC(=C2F)F)F)F |
Computed by PubChem (NCBI)