cas: 269410-04-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane, 95+% (CAS 269410-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A822830-250mg |
| cas | 269410-04-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2044.69 Pln | |
| Ambeed | 5g | 5237.56 Pln | |
| Ambeed | 10g | 8347.00 Pln | |
| BLDpharm | 100mg | 580.93 Pln | |
| BLDpharm | 250mg | 964.13 Pln | |
| BLDpharm | 1g | 2197.03 Pln | |
| BLDpharm | 5g | 5645.81 Pln | |
| BLDpharm | 10g | 8994.64 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane (CAS 269410-04-0) is a chemical compound with the molecular formula C15H23BO5 and a molecular weight of 294.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: LKEZAAIPHZMQDT-UHFFFAOYSA-N.
| Molecular formula | C15H23BO5 |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,4,6-trimethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | LKEZAAIPHZMQDT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2OC)OC)OC |
Computed by PubChem (NCBI)