Products 214360-67-5
CAS 214360-67-5 appears in our catalog under these names: 3,4,5-Trimethoxyphenylboronic acid, pinacol ester, 98%, 4,4,5,5-Tetramethyl-2-(3,4,5-Trimethoxyphenyl)-1,3,2-Dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-(3,4,5-trimethoxyphenyl)-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-(3,4,5-trimethoxyphenyl)-1,3,2-dioxaborolane (CAS 214360-67-5) is a chemical compound with the molecular formula C15H23BO5 and a molecular weight of 294.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trimethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: SEARINNLCHQTJH-UHFFFAOYSA-N.
| Molecular formula | C15H23BO5 |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trimethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | SEARINNLCHQTJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)