CAS 2121514-09-6 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2,3,4-trimethoxyphenyl)-1,3,2-dioxaborolane, 98%, 4,4,5,5-TETRAMETHYL-2-(2,3,4-TRIMETHOXYPHENYL)-1,3,2-DIOXABOROLANE, 97%, 97%, 2,3,4-Trimethoxyphenylboronic acid, pinacol ester, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(2,3,4-trimethoxyphenyl)-1,3,2-dioxaborolane (CAS 2121514-09-6) is a chemical compound with the molecular formula C15H23BO5 and a molecular weight of 294.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,3,4-trimethoxyphenyl)-1,3,2-dioxaborolane. InChIKey: JVZNHMFKJRROCU-UHFFFAOYSA-N.
| Molecular formula | C15H23BO5 |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,3,4-trimethoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | JVZNHMFKJRROCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)