cas: 1072945-09-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-(methylthio)phenyl)-1,3,2-dioxaborolane 98% (CAS 1072945-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103298-250mg |
| cas | 1072945-09-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A103298 |
4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 1072945-09-5) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: SLJWZEVOGXSTOM-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | SLJWZEVOGXSTOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2SC |
Computed by PubChem (NCBI)