4,4,5,5-Tetramethyl-2-(2-(methylthio)phenyl)-1,3,2-dioxaborolane, 98%, 98%
cas: 1072945-09-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-(methylthio)phenyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 1072945-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119S81-100mg |
| cas | 1072945-09-5 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 525.20 Pln | |
| Chemat | 25g | 957.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 1072945-09-5) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: SLJWZEVOGXSTOM-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | SLJWZEVOGXSTOM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2SC |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-Tetramethyl-2-(2-(methylthio)phenyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-[2-(methylthio)phenyl]-1,3,2-dioxaborolane, 2-Methylthiophenylboronic acid, pinacol ester, 2-Methylthiophenylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-[2-(methylsulfanyl)phenyl]-1,3,2-dioxaborolane, 2-(methylthio)phenylboronic acid pinacol ester, SLJWZEVOGXSTOM-UHFFFAOYSA-N, 4,4,5,5-Tetramethyl-2-[2-(methylsulfanyl)