CAS 66080-23-7 appears in our catalog under these names: 2-((Phenylthio)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 4,4,5,5-Tetramethyl-2-((phenylsulfanyl)methyl)-1,3,2-dioxaborolane, 4,4,5,5-TETRAMETHYL-2-PHENYLSULFANYLMETH. Offered by: Hoffman Fine Chemicals, Biosynth, Sigma-Aldrich. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 1g, 5G.
4,4,5,5-tetramethyl-2-(phenylsulfanylmethyl)-1,3,2-dioxaborolane (CAS 66080-23-7) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(phenylsulfanylmethyl)-1,3,2-dioxaborolane. InChIKey: DGPGLPBMZOKGON-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(phenylsulfanylmethyl)-1,3,2-dioxaborolane |
| InChIKey | DGPGLPBMZOKGON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CSC2=CC=CC=C2 |
Computed by PubChem (NCBI)