cas: 280559-30-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-phenylpropyl)-1,3,2-dioxaborolane 98% (CAS 280559-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340905-100mg |
| cas | 280559-30-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A340905 |
4,4,5,5-tetramethyl-2-(2-phenylpropyl)-1,3,2-dioxaborolane (CAS 280559-30-0) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylpropyl)-1,3,2-dioxaborolane. InChIKey: GTZNZJQZUWIDTN-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylpropyl)-1,3,2-dioxaborolane |
| InChIKey | GTZNZJQZUWIDTN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)