4,4,5,5-Tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane 97%
cas: 827614-70-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane 97% (CAS 827614-70-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175718-1g |
| cas | 827614-70-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 515.00 Pln | |
| Ambeed | 100g | 1560.75 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175718 |
4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane (CAS 827614-70-0) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane. InChIKey: VFCTUUBAONBDJU-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | VFCTUUBAONBDJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane, 3,4,5-trifluorophenylboronic acid, pinacol ester, 3,4,5-Trifluorophenylboronic acid pinacol ester, 2-(3,4,5-trifluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(3,4,5-Trifluorobenzene)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, VFCTUUBAONBDJU-UHFFFAOYSA-N, 4,4,5,5-Tetramethyl-2-(3,4,5-trifluoro-phenyl)-[1,3,2]dioxaborolane, 3,4,5-Trifluorophenylboronic acid pinacol ester, AldrichCPR, 1,2,3-Trifluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene