cas: 827614-70-0 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane, 97%, 97% (CAS 827614-70-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115Y5W-1g |
| cas | 827614-70-0 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 100g | 1067.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane (CAS 827614-70-0) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane. InChIKey: VFCTUUBAONBDJU-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | VFCTUUBAONBDJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)