cas: 827614-70-0 — see every product listed under this CAS number, including other names
2-(3,4,5-Trifluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 827614-70-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021640-5G |
| cas | 827614-70-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 581.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane (CAS 827614-70-0) is a chemical compound with the molecular formula C12H14BF3O2 and a molecular weight of 258.05 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane. InChIKey: VFCTUUBAONBDJU-UHFFFAOYSA-N.
| Molecular formula | C12H14BF3O2 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3,4,5-trifluorophenyl)-1,3,2-dioxaborolane |
| InChIKey | VFCTUUBAONBDJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)