cas: 710348-63-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-(methylthio)phenyl)-1,3,2-dioxaborolane, 95%, 95% (CAS 710348-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ESV-250mg |
| cas | 710348-63-3 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 458.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 710348-63-3) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: SVJUVGVKTGZKCG-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | SVJUVGVKTGZKCG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)SC |
Computed by PubChem (NCBI)