cas: 710348-63-3 — see every product listed under this CAS number, including other names
3-(Methylthio)phenylboronic acid pinacol ester, 98% (CAS 710348-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217587-1G |
| cas | 710348-63-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 10g | 299.91 Pln | |
| Fluorochem | 25g | 565.44 Pln | |
| Fluorochem | 100g | 1596.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 710348-63-3) is a chemical compound with the molecular formula C13H19BO2S and a molecular weight of 250.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: SVJUVGVKTGZKCG-UHFFFAOYSA-N.
| Molecular formula | C13H19BO2S |
|---|---|
| Molecular weight | 250.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | SVJUVGVKTGZKCG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)SC |
Computed by PubChem (NCBI)