cas: 912569-68-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-(phenoxymethyl)phenyl)-1,3,2-dioxaborolane, ≥97-<99% (CAS 912569-68-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC292-97-99-5g |
| cas | 912569-68-7 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 4033.92 Pln | |
| Hoffman Fine Chemicals | 10g | 6094.66 Pln | |
| Hoffman Fine Chemicals | 25g | 11887.70 Pln | |
| Hoffman Fine Chemicals | 50g | 18835.52 Pln | |
| Hoffman Fine Chemicals | 100g | 29949.48 Pln | |
| Hoffman Fine Chemicals | 200g | 50703.62 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane (CAS 912569-68-7) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: AFDZGEOQKHIWKF-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | AFDZGEOQKHIWKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC=CC=C3 |
Computed by PubChem (NCBI)