cas: 912569-68-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-(phenoxymethyl)phenyl)-1,3,2-dioxaborolane, 97% (CAS 912569-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F724027-100MG |
| cas | 912569-68-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1549.47 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane (CAS 912569-68-7) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: AFDZGEOQKHIWKF-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-(phenoxymethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | AFDZGEOQKHIWKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC=CC=C3 |
Computed by PubChem (NCBI)