cas: 1358754-54-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-methyl-4-phenylphenyl)-1,3,2-dioxaborolane (CAS 1358754-54-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627332-1G |
| cas | 1358754-54-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5199.23 Pln | |
| Fluorochem | 5g | 15466.45 Pln |
| delivery time | 3-4 weeks |
|---|
4,4,5,5-tetramethyl-2-(3-methyl-4-phenylphenyl)-1,3,2-dioxaborolane (CAS 1358754-54-7) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methyl-4-phenylphenyl)-1,3,2-dioxaborolane. InChIKey: YTVKJEZGUDWLRI-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methyl-4-phenylphenyl)-1,3,2-dioxaborolane |
| InChIKey | YTVKJEZGUDWLRI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)