CAS 1073355-05-1 appears in our catalog under these names: 3-Benzylphenylboronic acid pinacol ester, 96%, 2-(3-Benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%, 2-(3-Benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥97-<99%, 2-(3-Benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 3-Benzylbenzeneboronic acid pinacol ester, 97% . Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 5g, 25g, 1g, 50g, 100g, 200g, 300g.
2-(3-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073355-05-1) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 2-(3-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VNZSTZMLJUPNQM-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-(3-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VNZSTZMLJUPNQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)