CAS 2649399-93-7 appears in our catalog under these names: 2-Methylbiphenyl-4-ylboronic acid pinacol ester, 95%, 4,4,5,5-Tetramethyl-2-(3-methyl-(1,1'-biphenyl)-4-yl)-1,3,2-dioxaborolane, 98%, 2-Methylbiphenyl-4-ylboronic acid pinacol ester, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane (CAS 2649399-93-7) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane. InChIKey: VJNVOZIDAWDRNT-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-phenylphenyl)-1,3,2-dioxaborolane |
| InChIKey | VJNVOZIDAWDRNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)