cas: 1402884-05-2 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(3-propylphenyl)-1,3,2-dioxaborolane, 95-<97% (CAS 1402884-05-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC912-95-97-500mg |
| cas | 1402884-05-2 |
| size | 500mg |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 500mg | 4882.46 Pln | |
| Hoffman Fine Chemicals | 1g | 6171.22 Pln | |
| Hoffman Fine Chemicals | 2,5g | 11804.76 Pln | |
| Hoffman Fine Chemicals | 5g | 17304.32 Pln | |
| Hoffman Fine Chemicals | 10g | 29203.02 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(3-propylphenyl)-1,3,2-dioxaborolane (CAS 1402884-05-2) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-propylphenyl)-1,3,2-dioxaborolane. InChIKey: JGNYJUVXKHWGOD-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-propylphenyl)-1,3,2-dioxaborolane |
| InChIKey | JGNYJUVXKHWGOD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CCC |
Computed by PubChem (NCBI)