cas: 476620-20-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane (CAS 476620-20-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691737-250MG |
| cas | 476620-20-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 2283.59 Pln |
| delivery time | 3-4 weeks |
|---|
4,4,5,5-tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane (CAS 476620-20-9) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane. InChIKey: XXSMGZQARORQMO-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylthiophen-3-yl)-1,3,2-dioxaborolane |
| InChIKey | XXSMGZQARORQMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC=C2C |
Computed by PubChem (NCBI)