CAS 885692-91-1 appears in our catalog under these names: 3-Methylthiophene-2-boronic acid pinacol ester, 97%, 3-Methylthiophene-2-boronic acid pinacol ester, 95-<97%, 3-Methylthiophene-2-boronic acid pinacol ester, ≥97-<99%, 3–Methyl–2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiophene, 3-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene, >98.0%(GC)(T). Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, TCI, Ambeed. Available pack sizes: 10g, 5g, 1g, 100g, 200g, 300g, 400g, 500g.
4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 885692-91-1) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: DGJCULPYCMEHFZ-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | DGJCULPYCMEHFZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)C |
Computed by PubChem (NCBI)