CAS 910553-12-7 appears in our catalog under these names: 2-Methylthiophene-3-boronic acid pinacol ester, 95%, 2-Methylthiophene-3-boronic acid pinacol ester, 95-<97%, 4,4,5,5-Tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane, 95+%, 4,4,5,5-Tetramethyl-2-(2-methyl-3-thienyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane 95+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 10g, 50g, 100g, 0,5g.
4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane (CAS 910553-12-7) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane. InChIKey: YCOQKTIMEQOYNN-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane |
| InChIKey | YCOQKTIMEQOYNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C |
Computed by PubChem (NCBI)