cas: 870004-04-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-vinylphenyl)-1,3,2-dioxaborolane, 95-<97% (CAS 870004-04-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC330-95-97-25g |
| cas | 870004-04-9 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 3172.62 Pln | |
| Hoffman Fine Chemicals | 50g | 4563.46 Pln | |
| Hoffman Fine Chemicals | 100g | 7402.56 Pln | |
| Hoffman Fine Chemicals | 200g | 11651.64 Pln | |
| Hoffman Fine Chemicals | 300g | 13922.92 Pln | |
| Hoffman Fine Chemicals | 400g | 15741.22 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 870004-04-9) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ONBKTEDYJFZZCU-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ONBKTEDYJFZZCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)