cas: 870004-04-9 — see every product listed under this CAS number, including other names
4-VINYLPHENYLBORONIC ACID PINACOL ESTER (CAS 870004-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F466919-250MG |
| cas | 870004-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 25g | 1955.58 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 870004-04-9) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ONBKTEDYJFZZCU-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ONBKTEDYJFZZCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)