cas: 870004-04-9 — see every product listed under this CAS number, including other names
(4-vinylphenyl)boronic acid pinacol ester, 98%, 98% (CAS 870004-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEB6-250mg |
| cas | 870004-04-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1192.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 870004-04-9) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ONBKTEDYJFZZCU-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(4-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ONBKTEDYJFZZCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)