cas: 627526-54-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,2-dioxaborolane 98% (CAS 627526-54-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A966788-100mg |
| cas | 627526-54-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 893.25 Pln | |
| Ambeed | 1g | 2434.06 Pln | |
| Ambeed | 5g | 8341.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A966788 |
4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,2-dioxaborolane (CAS 627526-54-9) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,2-dioxaborolane. InChIKey: CAEUETONSQGECS-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | CAEUETONSQGECS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CCCC3)C=C2 |
Computed by PubChem (NCBI)