CAS 870717-91-2 appears in our catalog under these names: E-2-(4-Ethylphenyl)vinylboronic acid, pinacol ester, 95%, E-2-(4-Ethylphenyl)vinylboronic acid, pinacol ester, 95-<97%, E-2-(4-Ethylphenyl)vinylboronic acid, pinacol ester, ≥97-<99%, (E)-2-(4-Ethylstyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 1g, 250mg, 25g, 50g, 100g, 200g, 300g.
2-[(E)-2-(4-ethylphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 870717-91-2) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-[(E)-2-(4-ethylphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WXXFAINZQODXKD-VAWYXSNFSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-[(E)-2-(4-ethylphenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WXXFAINZQODXKD-VAWYXSNFSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC=C(C=C2)CC |
Computed by PubChem (NCBI)