CAS 2121514-70-1 appears in our catalog under these names: 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-Cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 3-Cyclobutylphenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-70-1) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SSMKDNHRLVKRFB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 2-(3-cyclobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SSMKDNHRLVKRFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3CCC3 |
Computed by PubChem (NCBI)