cas: 459409-74-6 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane 97% (CAS 459409-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104676-250mg |
| cas | 459409-74-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 10g | 1154.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A104676 |
4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 459409-74-6) is a chemical compound with the molecular formula C16H19BO2S and a molecular weight of 286.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: BOTJOCNWKJVWRR-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2S |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | BOTJOCNWKJVWRR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)