CAS 960116-25-0 is the registry number for 4-Phenylthiophene-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 960116-25-0) is a chemical compound with the molecular formula C16H19BO2S and a molecular weight of 286.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: YOEQUOGEMIDLFK-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2S |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | YOEQUOGEMIDLFK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)