Products 960116-25-0

CAS 960116-25-0 is the registry number for 4-Phenylthiophene-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 960116-25-0) is a chemical compound with the molecular formula C16H19BO2S and a molecular weight of 286.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: YOEQUOGEMIDLFK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19BO2S
Molecular weight286.2 g/mol
IUPAC name4,4,5,5-tetramethyl-2-(4-phenylthiophen-2-yl)-1,3,2-dioxaborolane
InChIKeyYOEQUOGEMIDLFK-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C3=CC=CC=C3

Computed by PubChem (NCBI)