CAS 1056474-34-0 appears in our catalog under these names: 4-(Thiophen-2-yl)phenylboronic acid pinacol ester, 97%, 4,4,5,5-Tetramethyl-2-(4-(thiophen-2-yl)phenyl)-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4,4,5,5-tetramethyl-2-(4-thiophen-2-ylphenyl)-1,3,2-dioxaborolane (CAS 1056474-34-0) is a chemical compound with the molecular formula C16H19BO2S and a molecular weight of 286.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-thiophen-2-ylphenyl)-1,3,2-dioxaborolane. InChIKey: NPXXIOJSOCXPHL-UHFFFAOYSA-N.
| Molecular formula | C16H19BO2S |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-thiophen-2-ylphenyl)-1,3,2-dioxaborolane |
| InChIKey | NPXXIOJSOCXPHL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=CS3 |
Computed by PubChem (NCBI)