cas: 2246658-69-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(oxetan-3-ylidenemethyl)-1,3,2-dioxaborolane, 98%, 98% (CAS 2246658-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WJN9-100mg |
| cas | 2246658-69-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| Chemat | 5g | 5181.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(oxetan-3-ylidenemethyl)-1,3,2-dioxaborolane (CAS 2246658-69-3) is a chemical compound with the molecular formula C10H17BO3 and a molecular weight of 196.05 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxetan-3-ylidenemethyl)-1,3,2-dioxaborolane. InChIKey: DIWDQIIXPVPQNZ-UHFFFAOYSA-N.
| Molecular formula | C10H17BO3 |
|---|---|
| Molecular weight | 196.05 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxetan-3-ylidenemethyl)-1,3,2-dioxaborolane |
| InChIKey | DIWDQIIXPVPQNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2COC2 |
Computed by PubChem (NCBI)