CAS 1346264-22-9 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(pentan-3-yl)-1,3,2-dioxaborolane, 95-<97%, 4,4,5,5-Tetramethyl-2-(pentan-3-yl)-1,3,2-dioxaborolane, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g.
4,4,5,5-tetramethyl-2-pentan-3-yl-1,3,2-dioxaborolane (CAS 1346264-22-9) is a chemical compound with the molecular formula C11H23BO2 and a molecular weight of 198.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pentan-3-yl-1,3,2-dioxaborolane. InChIKey: AVANTDXOOXMYDJ-UHFFFAOYSA-N.
| Molecular formula | C11H23BO2 |
|---|---|
| Molecular weight | 198.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pentan-3-yl-1,3,2-dioxaborolane |
| InChIKey | AVANTDXOOXMYDJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(CC)CC |
Computed by PubChem (NCBI)