CAS 2551029-50-4 is the registry number for 4,4,5,5-Tetramethyl-2-(pentan-2-yl)-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
4,4,5,5-tetramethyl-2-pentan-2-yl-1,3,2-dioxaborolane (CAS 2551029-50-4) is a chemical compound with the molecular formula C11H23BO2 and a molecular weight of 198.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-pentan-2-yl-1,3,2-dioxaborolane. InChIKey: SOJXCHKRMLZVGA-UHFFFAOYSA-N.
| Molecular formula | C11H23BO2 |
|---|---|
| Molecular weight | 198.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-pentan-2-yl-1,3,2-dioxaborolane |
| InChIKey | SOJXCHKRMLZVGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)CCC |
Computed by PubChem (NCBI)