Products 255041-53-3

CAS 255041-53-3 is the registry number for 2-Isopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane (CAS 255041-53-3) is a chemical compound with the molecular formula C11H23BO2 and a molecular weight of 198.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane. InChIKey: RRGXVRVZHMLFGU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23BO2
Molecular weight198.11 g/mol
IUPAC name4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane
InChIKeyRRGXVRVZHMLFGU-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)CCC(C)C

Computed by PubChem (NCBI)