CAS 255041-53-3 is the registry number for 2-Isopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g.
4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane (CAS 255041-53-3) is a chemical compound with the molecular formula C11H23BO2 and a molecular weight of 198.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane. InChIKey: RRGXVRVZHMLFGU-UHFFFAOYSA-N.
| Molecular formula | C11H23BO2 |
|---|---|
| Molecular weight | 198.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylbutyl)-1,3,2-dioxaborolane |
| InChIKey | RRGXVRVZHMLFGU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(C)C |
Computed by PubChem (NCBI)