4,4,5,5-Tetramethyl-2-(phenylethynyl)-1,3,2-dioxaborolane, 95%, 95%
cas: 159087-45-3 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(phenylethynyl)-1,3,2-dioxaborolane, 95%, 95% (CAS 159087-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QGF-250mg |
| cas | 159087-45-3 |
| size | 250mg |
| availability | 28.5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1389.20 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| Chemat | 25g | 4701.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(2-phenylethynyl)-1,3,2-dioxaborolane (CAS 159087-45-3) is a chemical compound with the molecular formula C14H17BO2 and a molecular weight of 228.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenylethynyl)-1,3,2-dioxaborolane. InChIKey: VEIORNIWTVJLCN-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-phenylethynyl)-1,3,2-dioxaborolane |
| InChIKey | VEIORNIWTVJLCN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#CC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-tetramethyl-2-(2-phenylethynyl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(phenylethynyl)-1,3,2-dioxaborolane, 2-Phenyl-1-ethynylboronic acid pinacol ester, 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-phenylethynyl)-, VEIORNIWTVJLCN-UHFFFAOYSA-N, (PHENYLETHYNYL)BORONIC ACID PINACOL ESTER, 2-Phenyl-1-ethynylboronic acid pinacol ester, 90%