cas: 827342-36-9 — see every product listed under this CAS number, including other names
4,4,6-Trimethyl-5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione 95% (CAS 827342-36-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A779531-100mg |
| cas | 827342-36-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 587.31 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A779531 |
9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione (CAS 827342-36-9) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: 9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione. InChIKey: YKDZCUAXADGLRL-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione |
| InChIKey | YKDZCUAXADGLRL-UHFFFAOYSA-N |
| SMILES | CC1CC(N2C3=C1C=CC=C3C(=O)C2=O)(C)C |
Computed by PubChem (NCBI)