Products 892874-63-4
CAS 892874-63-4 appears in our catalog under these names: Ethyl 2,6-dimethylquinoline-3-carboxylate, 95%, ethyl 2,6-dimethylquinoline-3-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 2,6-dimethylquinoline-3-carboxylate (CAS 892874-63-4) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: ethyl 2,6-dimethylquinoline-3-carboxylate. InChIKey: NGDSVASJKBMFEA-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | ethyl 2,6-dimethylquinoline-3-carboxylate |
| InChIKey | NGDSVASJKBMFEA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)C)C |
Computed by PubChem (NCBI)