CAS 724744-88-1 appears in our catalog under these names: 1,2,4-Trimethyl-5-phenyl-1h-pyrrole-3-carboxylic acid, 95%, 1,2,4-Trimethyl-5-phenyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
1,2,4-trimethyl-5-phenylpyrrole-3-carboxylic acid (CAS 724744-88-1) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: 1,2,4-trimethyl-5-phenylpyrrole-3-carboxylic acid. InChIKey: KNTRJGNNOUVCOH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1,2,4-trimethyl-5-phenylpyrrole-3-carboxylic acid |
| InChIKey | KNTRJGNNOUVCOH-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=C1C(=O)O)C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)