4,4′,4′′-Tris(N-carbazolyl)triphenylamine, 95-<97% (CAS 139092-78-7) manufactured by Hoffman Fine Chemicals in a 300g pack.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC637-95-97-300g |
| cas | 139092-78-7 |
| size | 300g |
| availability | 3-4 tygodnie|3-4 weeks |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline (CAS 139092-78-7) is a chemical compound with the molecular formula C54H36N4 and a molecular weight of 740.9 g/mol. IUPAC name: 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline. InChIKey: AWXGSYPUMWKTBR-UHFFFAOYSA-N.
| Molecular formula | C54H36N4 |
|---|---|
| Molecular weight | 740.9 g/mol |
| IUPAC name | 4-carbazol-9-yl-N,N-bis(4-carbazol-9-ylphenyl)aniline |
| InChIKey | AWXGSYPUMWKTBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)N(C5=CC=C(C=C5)N6C7=CC=CC=C7C8=CC=CC=C86)C9=CC=C(C=C9)N1C2=CC=CC=C2C2=CC=CC=C21 |
Computed by PubChem (NCBI)