4,5,6,7-TETRACHLORO-1H-INDENE-1,3(2H)-DIONE, 97%
cas: 30675-13-9 — see every product listed under this CAS number, including other names
4,5,6,7-TETRACHLORO-1H-INDENE-1,3(2H)-DIONE, 97% (CAS 30675-13-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 1mg, 5mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F826951-250MG |
| cas | 30675-13-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1486.99 Pln | |
| Fluorochem | 1g | 3881.98 Pln | |
| Fluorochem | 1mg | 315.53 Pln | |
| Fluorochem | 5mg | 841.39 Pln | |
| Fluorochem | 100mg | 909.07 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,5,6,7-tetrachloroindene-1,3-dione (CAS 30675-13-9) is a chemical compound with the molecular formula C9H2Cl4O2 and a molecular weight of 283.9 g/mol. IUPAC name: 4,5,6,7-tetrachloroindene-1,3-dione. InChIKey: IDLAOWFFKWRNHB-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl4O2 |
|---|---|
| Molecular weight | 283.9 g/mol |
| IUPAC name | 4,5,6,7-tetrachloroindene-1,3-dione |
| InChIKey | IDLAOWFFKWRNHB-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4,5,6,7-tetrachloro-2,3-dihydro-1H-indene-1,3-dione, TCID, 4,5,6,7-Tetrachloro-1H-indene-1,3(2H)-dione, 4,5,6,7-Tetrachloroindan-1,3-dione, 4,5,6,7-tetrachloroindene-1,3-dione, 4,5,6,7-Tetrachloroindane-1,3-dione, 1H-Indene-1,3(2H)-dione, 4,5,6,7-tetrachloro-, C9H2Cl4O2, compound 6 [PMID: 17948018], Maybridge1_006552