cas: 30675-13-9 — see every product listed under this CAS number, including other names
TCID, 99%, 99% (CAS 30675-13-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6RC-1mg |
| cas | 30675-13-9 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 174.80 Pln | |
| Chemat | 5mg | 525.20 Pln | |
| Chemat | 25mg | 1754.00 Pln | |
| Chemat | 100mg | 4806.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
4,5,6,7-tetrachloroindene-1,3-dione (CAS 30675-13-9) is a chemical compound with the molecular formula C9H2Cl4O2 and a molecular weight of 283.9 g/mol. IUPAC name: 4,5,6,7-tetrachloroindene-1,3-dione. InChIKey: IDLAOWFFKWRNHB-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl4O2 |
|---|---|
| Molecular weight | 283.9 g/mol |
| IUPAC name | 4,5,6,7-tetrachloroindene-1,3-dione |
| InChIKey | IDLAOWFFKWRNHB-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)