CAS 30675-13-9 appears in our catalog under these names: 4,5,6,7-tetrachloro-2H-indene-1,3-dione, 96%, TCID, TCID/ 97.16% (existing batch purity), TCID, 99%, 99%, 4,5,6,7-TETRACHLORO-1H-INDENE-1,3(2H)-DIONE, 97%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 2mg.
4,5,6,7-tetrachloroindene-1,3-dione (CAS 30675-13-9) is a chemical compound with the molecular formula C9H2Cl4O2 and a molecular weight of 283.9 g/mol. IUPAC name: 4,5,6,7-tetrachloroindene-1,3-dione. InChIKey: IDLAOWFFKWRNHB-UHFFFAOYSA-N.
| Molecular formula | C9H2Cl4O2 |
|---|---|
| Molecular weight | 283.9 g/mol |
| IUPAC name | 4,5,6,7-tetrachloroindene-1,3-dione |
| InChIKey | IDLAOWFFKWRNHB-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)